Introduction：Basic information about CAS 833-66-9|Potassium 6-hydroxy-2-naphthalenesulfonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Potassium 6-hydroxy-2-naphthalenesulfonate |
|---|
| CAS Number | 833-66-9 | Molecular Weight | 262.323 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C10H7KO4S | Melting Point | 155-157 (dec.) |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Potassium 6-Hydroxy-2-naphthalenesulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 155-157 (dec.) |
|---|
| Molecular Formula | C10H7KO4S |
|---|
| Molecular Weight | 262.323 |
|---|
| Exact Mass | 261.970215 |
|---|
| PSA | 85.81000 |
|---|
| LogP | 2.53030 |
|---|
| InChIKey | PZWWSVPMGHDZNJ-UHFFFAOYSA-M |
|---|
| SMILES | O=S(=O)([O-])c1ccc2cc(O)ccc2c1.[K+] |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | R22:Harmful if swallowed. R38:Irritating to the skin. |
|---|
| Safety Phrases | S36 |
|---|
| WGK Germany | 3 |
|---|
| RTECS | UX9280000 |
|---|
| HS Code | 2908999090 |
|---|
Customs
| HS Code | 2908999090 |
|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 2-Naphthalenesulfonic acid, 6-hydroxy-, monopotassium salt |
| 2-Naphthol-6-sulfonic acid potassium salt |
| 2-Naphthalenesulfonic acid, 6-hydroxy-, potassium salt (1:1) |
| Potassium 6-hydroxy-2-naphthalenesulfonate |
| potassium 6-hydroxynaphthalene-2-sulfonate |
| EINECS 212-631-0 |
| MFCD06797149 |
