Introduction：Basic information about CAS 1579-89-1|5-Acetomino-2-amino Benzotrifluoride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Acetomino-2-amino Benzotrifluoride |
|---|
| CAS Number | 1579-89-1 | Molecular Weight | 218.176 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 261.4±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H9F3N2O | Melting Point | 119 °C |
|---|
| MSDS | / | Flash Point | 111.9±27.3 °C |
|---|
Names
| Name | 4'-Amino-3'-(trifluoromethyl)acetanilide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 261.4±40.0 °C at 760 mmHg |
|---|
| Melting Point | 119 °C |
|---|
| Molecular Formula | C9H9F3N2O |
|---|
| Molecular Weight | 218.176 |
|---|
| Flash Point | 111.9±27.3 °C |
|---|
| Exact Mass | 218.066696 |
|---|
| PSA | 55.12000 |
|---|
| LogP | 2.10 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.541 |
|---|
| InChIKey | QMCLCXKXDXBQLB-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Nc1ccc(N)c(C(F)(F)F)c1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | R22:Harmful if swallowed. |
|---|
| Safety Phrases | S24/25 |
|---|
| RIDADR | UN 2282 3/PG 3 |
|---|
| WGK Germany | 1 |
|---|
| RTECS | MQ4025000 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 3 |
|---|
| HS Code | 29051900 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-(4-Amino-3-(trifluoromethyl)phenyl)acetamide |
| 4-Acetamido-2-(trifluoromethyl)aniline |
| MFCD00270762 |
| 5-Acetomino-2-amino Benzotrifluoride |
| N-[4-Amino-3-(trifluoromethyl)phenyl]acetamide |
| 2-Amino-5-acetamidobenzotrifluoride |
| Acetamide, N-[4-amino-3-(trifluoromethyl)phenyl]- |
| 5-Acetamido-2-aminobenzotrifluoride |
