Introduction:Basic information about CAS 510-64-5|19-Hydroxy-4-androsten-3,17-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 19-Hydroxy-4-androsten-3,17-dione |
|---|
| CAS Number | 510-64-5 | Molecular Weight | 302.408 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 485.4±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H26O3 | Melting Point | 168-169ºC(lit.) |
|---|
| MSDS | / | Flash Point | 261.5±25.2 °C |
|---|
Names
| Name | 19-hydroxyandrost-4-ene-3,17-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 485.4±45.0 °C at 760 mmHg |
|---|
| Melting Point | 168-169ºC(lit.) |
|---|
| Molecular Formula | C19H26O3 |
|---|
| Molecular Weight | 302.408 |
|---|
| Flash Point | 261.5±25.2 °C |
|---|
| Exact Mass | 302.188202 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 1.29 |
|---|
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.571 |
|---|
| InChIKey | XGUHPTGEXRHMQQ-BGJMDTOESA-N |
|---|
| SMILES | CC12CCC3C(CCC4=CC(=O)CCC43CO)C1CCC2=O |
|---|
| Storage condition | -20°C Freezer |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 22-24/25-36/37/39-27-26 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| (8R,9S,10S,13S,14S)-10-(hydroxymethyl)-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| 19-Hydroxy-4-androsten-3,17-dione |
| 19-Hydroxyandrostendione |
| MFCD00003616 |
| 4-Androsten-19-ol-3,17-dione,4-Androstene-3,17-dione-19-ol |
| EINECS 208-116-5 |
| 19-Hydroxyandrost-4-ene-3,17-dione |
| 19-Hydroxy-4-androstene-3,17-dione |
| Androst-4-ene-3,17-dione, 19-hydroxy- |