Introduction：Basic information about CAS 26948-96-9|resorcinol sulfoxide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | resorcinol sulfoxide |
|---|
| CAS Number | 26948-96-9 | Molecular Weight | 266.27000 |
|---|
| Density | 1.78g/cm3 | Boiling Point | 561ºC at 760mmHg |
|---|
| Molecular Formula | C12H10O5S | Melting Point | 151ºC |
|---|
| MSDS | / | Flash Point | 293.1ºC |
|---|
Names
| Name | resorcinol sulfoxide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.78g/cm3 |
|---|
| Boiling Point | 561ºC at 760mmHg |
|---|
| Melting Point | 151ºC |
|---|
| Molecular Formula | C12H10O5S |
|---|
| Molecular Weight | 266.27000 |
|---|
| Flash Point | 293.1ºC |
|---|
| Exact Mass | 266.02500 |
|---|
| PSA | 117.20000 |
|---|
| LogP | 2.54140 |
|---|
| Vapour Pressure | 3.61E-15mmHg at 25°C |
|---|
| Index of Refraction | 1.846 |
|---|
| InChIKey | WUDPYTUCYMDYKB-UHFFFAOYSA-N |
|---|
| SMILES | O=S(c1c(O)cccc1O)c1c(O)cccc1O |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 24/25 |
|---|
Synonyms
| Bis(2,4-dihydroxyphenyl) sulfoxide |
| 4,4'-sulphinyldiresorcinol |
| Resorcinolsulfoxidetech |
| EINECS 248-129-3 |
| MFCD00012062 |
| 4,4'-Sulfinylbisresorcinol |
| 4,4'-SULFINYLDIRESORCINOL |
| Resorcinol sulfoxide4,4'-Sulfinyldiresorcinol |
