Introduction：Basic information about CAS 850374-98-0|methyl 3-iodo-1h-indole-6-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | methyl 3-iodo-1h-indole-6-carboxylate |
|---|
| CAS Number | 850374-98-0 | Molecular Weight | 301.08000 |
|---|
| Density | 1.86g/cm3 | Boiling Point | 408ºC at 760 mmHg |
|---|
| Molecular Formula | C10H8INO2 | Melting Point | 150(dec.)ºC |
|---|
| MSDS | / | Flash Point | 200.6ºC |
|---|
Names
| Name | methyl 3-iodo-1h-indole-6-carboxylate |
|---|
Chemical & Physical Properties
| Density | 1.86g/cm3 |
|---|
| Boiling Point | 408ºC at 760 mmHg |
|---|
| Melting Point | 150(dec.)ºC |
|---|
| Molecular Formula | C10H8INO2 |
|---|
| Molecular Weight | 301.08000 |
|---|
| Flash Point | 200.6ºC |
|---|
| Exact Mass | 300.96000 |
|---|
| PSA | 42.09000 |
|---|
| LogP | 2.55910 |
|---|
| Index of Refraction | 1.709 |
|---|
| InChIKey | WUFYFIRKVXAESN-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1ccc2c(I)c[nH]c2c1 |
|---|
