Introduction:Basic information about CAS 53715-64-3|ethyl 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate |
|---|
| CAS Number | 53715-64-3 | Molecular Weight | 247.31300 |
|---|
| Density | 1.188g/cm3 | Boiling Point | 150ºC |
|---|
| Molecular Formula | C13H13NO2S | Melting Point | 36-39ºC |
|---|
| MSDS | / | Flash Point | 179.3ºC |
|---|
Names
| Name | ethyl 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.188g/cm3 |
|---|
| Boiling Point | 150ºC |
|---|
| Melting Point | 36-39ºC |
|---|
| Molecular Formula | C13H13NO2S |
|---|
| Molecular Weight | 247.31300 |
|---|
| Flash Point | 179.3ºC |
|---|
| Exact Mass | 247.06700 |
|---|
| PSA | 67.43000 |
|---|
| LogP | 3.29520 |
|---|
| Index of Refraction | 1.572 |
|---|
| InChIKey | FYPLITQTMHJFKK-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1sc(-c2ccccc2)nc1C |
|---|
Safety Information
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | R22;R36/37/38 |
|---|
| Safety Phrases | S22-S26-S36/37/39 |
|---|
| HS Code | 2934100090 |
|---|
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| ethyl 2-phenyl-4-methylthiazole-5-carboxylate |
| MFCD00141953 |
| 4-Methyl-2-phenyl-thiazol-5-carbonsaeure-aethylester |
| 5-Aethoxycarbonyl-4-methyl-2-phenyl-thiazol |
| 5-Ethoxycarbonyl-4-methyl-2-phenyl-thiazol |
| 4-methyl-2-phenyl-thiazole-5-carboxylic acid ethyl ester |
| ethyl 4-methyl-2-phenylthiazole-5-carboxylate |