Introduction：Basic information about CAS 845266-33-3|3-(3,4-dimethoxyphenyl)-5-(trifluoromethyl)-1h-pyrazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(3,4-dimethoxyphenyl)-5-(trifluoromethyl)-1h-pyrazole |
|---|
| CAS Number | 845266-33-3 | Molecular Weight | 272.22300 |
|---|
| Density | 1.31g/cm3 | Boiling Point | 382.6ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11F3N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 185.2ºC |
|---|
Names
| Name | 3-(3,4-dimethoxyphenyl)-5-(trifluoromethyl)-1h-pyrazole |
|---|
Chemical & Physical Properties
| Density | 1.31g/cm3 |
|---|
| Boiling Point | 382.6ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11F3N2O2 |
|---|
| Molecular Weight | 272.22300 |
|---|
| Flash Point | 185.2ºC |
|---|
| Exact Mass | 272.07700 |
|---|
| PSA | 47.14000 |
|---|
| LogP | 3.11270 |
|---|
| Index of Refraction | 1.505 |
|---|
| InChIKey | URPKSFQMOBREDT-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(-c2cc(C(F)(F)F)[nH]n2)cc1OC |
|---|
