Introduction：Basic information about CAS 680215-52-5|4-phenyl-5-(trifluoromethyl)thiophene-3-sulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-phenyl-5-(trifluoromethyl)thiophene-3-sulfonyl chloride |
|---|
| CAS Number | 680215-52-5 | Molecular Weight | 326.74200 |
|---|
| Density | 1.312g/cm3 | Boiling Point | 378.3ºC at 760 mmHg |
|---|
| Molecular Formula | C11H6ClF3O2S2 | Melting Point | 85-87ºC |
|---|
| MSDS | / | Flash Point | 182.6ºC |
|---|
Names
| Name | 4-phenyl-5-(trifluoromethyl)thiophene-3-sulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.312g/cm3 |
|---|
| Boiling Point | 378.3ºC at 760 mmHg |
|---|
| Melting Point | 85-87ºC |
|---|
| Molecular Formula | C11H6ClF3O2S2 |
|---|
| Molecular Weight | 326.74200 |
|---|
| Flash Point | 182.6ºC |
|---|
| Exact Mass | 325.94500 |
|---|
| PSA | 70.76000 |
|---|
| LogP | 5.44220 |
|---|
| Index of Refraction | 1.518 |
|---|
| InChIKey | OSYDWXUOQYZLKB-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)c1csc(C(F)(F)F)c1-c1ccccc1 |
|---|
Synonyms
