Introduction:Basic information about CAS 850375-37-0|5-(chloromethyl)-3-[(4-methylphenoxy)methyl]-1,2,4-oxadiazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(chloromethyl)-3-[(4-methylphenoxy)methyl]-1,2,4-oxadiazole |
|---|
| CAS Number | 850375-37-0 | Molecular Weight | 238.67000 |
|---|
| Density | 1.273g/cm3 | Boiling Point | 384.7ºC at 760 mmHg |
|---|
| Molecular Formula | C11H11ClN2O2 | Melting Point | 33ºC |
|---|
| MSDS | / | Flash Point | 186.5ºC |
|---|
Names
| Name | 5-(chloromethyl)-3-[(4-methylphenoxy)methyl]-1,2,4-oxadiazole |
|---|
Chemical & Physical Properties
| Density | 1.273g/cm3 |
|---|
| Boiling Point | 384.7ºC at 760 mmHg |
|---|
| Melting Point | 33ºC |
|---|
| Molecular Formula | C11H11ClN2O2 |
|---|
| Molecular Weight | 238.67000 |
|---|
| Flash Point | 186.5ºC |
|---|
| Exact Mass | 238.05100 |
|---|
| PSA | 48.15000 |
|---|
| LogP | 2.69580 |
|---|
| Index of Refraction | 1.559 |
|---|
| InChIKey | JMIICLSRTGZOQN-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(OCc2noc(CCl)n2)cc1 |
|---|