Introduction：Basic information about CAS 5710-54-3|1,2-Benzenedisulfonicacid, potassium salt (1:2), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,2-Benzenedisulfonicacid, potassium salt (1:2) |
|---|
| CAS Number | 5710-54-3 | Molecular Weight | 314.41900 |
|---|
| Density | 1.764g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C6H4K2O6S2 | Melting Point | ≥300ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
Names
| Name | dipotassium,benzene-1,2-disulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.764g/cm3 |
|---|
| Melting Point | ≥300ºC(lit.) |
|---|
| Molecular Formula | C6H4K2O6S2 |
|---|
| Molecular Weight | 314.41900 |
|---|
| Exact Mass | 313.87200 |
|---|
| PSA | 131.16000 |
|---|
| LogP | 1.65640 |
|---|
| InChIKey | GUODQJCZAMWCIJ-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(O)c1ccccc1S(=O)(=O)O.[K] |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xn |
|---|
| Risk Phrases | 20/21/22-36/37/38 |
|---|
| Safety Phrases | S22-S24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| Potassium benzene-1,2-disulfonate |
| o-Benzenedisulfonic acid dipotassium salt |
| benzol-1,2-dikalium-disulfonate |
| B3159_ALDRICH |
| dipotassium o-benzenedisulfonate |
| Benzene-1,2-disulfonic acid dipotassium salt |
| potassium o-benzenedisulfonate |
| 1,2-benzenedisulfonic acid dipotassium salt |
| Dipotassium Benzene-1,2-disulfonate |
| EINECS 227-199-9 |
| dipotassium 1,2-benzenedisulphonate |
| MFCD00007477 |
