CAS 40724-67-2|(1S,4R)-7,7-Dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxylic acid
Introduction：Basic information about CAS 40724-67-2|(1S,4R)-7,7-Dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (1S,4R)-7,7-Dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxylic acid | ||
|---|---|---|---|
| CAS Number | 40724-67-2 | Molecular Weight | 182.216 |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 313.3±25.0 °C at 760 mmHg |
| Molecular Formula | C10H14O3 | Melting Point | 237-239 °C(lit.) |
| MSDS | ChineseUSA | Flash Point | 157.5±19.7 °C |
| Symbol | GHS07 | Signal Word | Warning |
Names
| Name | (s)-(+)-ketopinic acid |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 313.3±25.0 °C at 760 mmHg |
| Melting Point | 237-239 °C(lit.) |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.216 |
| Flash Point | 157.5±19.7 °C |
| Exact Mass | 182.094299 |
| PSA | 54.37000 |
| LogP | 0.70 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.535 |
| InChIKey | WDODWBQJVMBHCO-LDWIPMOCSA-N |
| SMILES | CC1(C)C2CCC1(C(=O)O)C(=O)C2 |
| Storage condition | 2-8°C |
Safety Information
| Symbol | GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
Articles4
More Articles| Yan, T.-H. et al. Tetrahedron Lett. 32 , 4959, (1991) | |
| Calmes, M. et al. Tetrahedron Asymmetry 5 , 817, (1994) | |
| Deng, J. et al. Synthesis , 963, (1991) |
Synonyms
| (1S,4R)-2-Oxobornane-10-oic acid |
| (1S,4R)-7,7-Dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxylic acid |
| (S)-7,7-DIMETHYL-2-OXO-BICYCLO[2.2.1]HEPTANE-1-CARBOXYLIC ACID |
| (1S,4R)-7,7-Dimethyl-2-oxobicyclo[2.2.1]-1-carboxylic acid |
| (1s)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxylic acid |
| MFCD08061242 |
| (S)-(+)-Ketopinic acid |
| (1S)-(+)-KETOPINIC ACID |
| (+)-Ketopinic acid |
| Bicyclo[2.2.1]heptane-1-carboxylic acid, 7,7-dimethyl-2-oxo-, (1S,4R)- |
| S-(+)-ketopinic acid |
| rac-(1S*,4R*)-2-Oxobornane-10-oic acid |
| (1S,4R)-Ketopinic acid |
| 7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxylic acid |
