Introduction：Basic information about CAS 676352-86-6|5-tert-butyl-2-(2-ethylhexylsulfanyl)aniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-tert-butyl-2-(2-ethylhexylsulfanyl)aniline |
|---|
| CAS Number | 676352-86-6 | Molecular Weight | 293.51000 |
|---|
| Density | 0.96 | Boiling Point | 391.362ºC at 760 mmHg |
|---|
| Molecular Formula | C18H31NS | Melting Point | / |
|---|
| MSDS | / | Flash Point | 190.489ºC |
|---|
Names
| Name | 5-tert-butyl-2-(2-ethylhexylsulfanyl)aniline |
|---|
Chemical & Physical Properties
| Density | 0.96 |
|---|
| Boiling Point | 391.362ºC at 760 mmHg |
|---|
| Molecular Formula | C18H31NS |
|---|
| Molecular Weight | 293.51000 |
|---|
| Flash Point | 190.489ºC |
|---|
| Exact Mass | 293.21800 |
|---|
| PSA | 51.32000 |
|---|
| LogP | 6.45600 |
|---|
| Index of Refraction | 1.529 |
|---|
| InChIKey | AVLSDPRGRUUKBD-UHFFFAOYSA-N |
|---|
| SMILES | CCCCC(CC)CSc1ccc(C(C)(C)C)cc1N |
|---|
