Introduction：Basic information about CAS 20731-63-9|Benzamide,4-chloro-3,5-dinitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzamide,4-chloro-3,5-dinitro- |
|---|
| CAS Number | 20731-63-9 | Molecular Weight | 245.57700 |
|---|
| Density | 1.708g/cm3 | Boiling Point | 319.1ºC at 760mmHg |
|---|
| Molecular Formula | C7H4ClN3O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 146.8ºC |
|---|
Names
| Name | 4-chloro-3,5-dinitrobenzamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.708g/cm3 |
|---|
| Boiling Point | 319.1ºC at 760mmHg |
|---|
| Molecular Formula | C7H4ClN3O5 |
|---|
| Molecular Weight | 245.57700 |
|---|
| Flash Point | 146.8ºC |
|---|
| Exact Mass | 244.98400 |
|---|
| PSA | 134.73000 |
|---|
| LogP | 3.00200 |
|---|
| Vapour Pressure | 0.000346mmHg at 25°C |
|---|
| Index of Refraction | 1.661 |
|---|
| InChIKey | XIYABENEBOSULF-UHFFFAOYSA-N |
|---|
| SMILES | NC(=O)c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| AC1L3G8O |
| EINECS 243-998-5 |
| CTK4E4963 |
| 3.5-Dinitro-4-chlor-benzamid |
| Benzamide,4-chloro-3,5-dinitro |
| 4-Chlor-3.5-dinitro-benzamid |
| 4-Chlor-3,5-dinitro-benzoesaeure-amid |
| 4-chloro-3,5-dinitro-benzoic acid amide |
