Introduction：Basic information about CAS 423-54-1|perfluorooctanamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | perfluorooctanamide |
|---|
| CAS Number | 423-54-1 | Molecular Weight | 413.08400 |
|---|
| Density | 1.696g/cm3 | Boiling Point | 190.7ºC at 760mmHg |
|---|
| Molecular Formula | C8H2F15NO | Melting Point | 137-139ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.696g/cm3 |
|---|
| Boiling Point | 190.7ºC at 760mmHg |
|---|
| Melting Point | 137-139ºC |
|---|
| Molecular Formula | C8H2F15NO |
|---|
| Molecular Weight | 413.08400 |
|---|
| Exact Mass | 412.99000 |
|---|
| PSA | 43.09000 |
|---|
| LogP | 4.54610 |
|---|
| Vapour Pressure | 0.535mmHg at 25°C |
|---|
| Index of Refraction | 1.295 |
|---|
| InChIKey | UGMUDSKJLAUMTC-UHFFFAOYSA-N |
|---|
| SMILES | NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2924199090 |
|---|
Customs
| HS Code | 2924199090 |
|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Pentadecafluor-octansaeure-amid |
| EINECS 207-027-9 |
| Perfluor-octansaeureamid |
| pentadecafluoro-octanoic acid amide |
| perfluorooctyl amide |
| pentadecafluorooctanamide |
| MFCD00039774 |
| perfluorooctanoic acid amide |
| Perfluorooctanamide |
