Introduction：Basic information about CAS 70216-88-5|4-[(6-Chloro-2-benzothiazolyl)oxy]phenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[(6-Chloro-2-benzothiazolyl)oxy]phenol |
|---|
| CAS Number | 70216-88-5 | Molecular Weight | 277.72600 |
|---|
| Density | 1.483g/cm3 | Boiling Point | 453.1ºC at 760 mmHg |
|---|
| Molecular Formula | C13H8ClNO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 227.8ºC |
|---|
Names
| Name | 4-[(6-chloro-1,3-benzothiazol-2-yl)oxy]phenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.483g/cm3 |
|---|
| Boiling Point | 453.1ºC at 760 mmHg |
|---|
| Molecular Formula | C13H8ClNO2S |
|---|
| Molecular Weight | 277.72600 |
|---|
| Flash Point | 227.8ºC |
|---|
| Exact Mass | 276.99600 |
|---|
| PSA | 70.59000 |
|---|
| LogP | 4.44760 |
|---|
| Index of Refraction | 1.718 |
|---|
| InChIKey | RGECUFYJLMZQOI-UHFFFAOYSA-N |
|---|
| SMILES | Oc1ccc(Oc2nc3ccc(Cl)cc3s2)cc1 |
|---|
Synonyms
| 4-(6-chloro-benzothiazol-2-yloxy)-phenol |
| 4-(6'-Chlorbenzthiazolyl-2'-oxy)phenol |
| 4-((6-Chloro-2-benzothiazolyl)oxy)phenol |
