Introduction：Basic information about CAS 73092-79-2|Benzoic acid, 4-chloro-, 4-hydroxyphenyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzoic acid, 4-chloro-, 4-hydroxyphenyl ester |
|---|
| CAS Number | 73092-79-2 | Molecular Weight | 248.66200 |
|---|
| Density | 1.357g/cm3 | Boiling Point | 417.586ºC at 760 mmHg |
|---|
| Molecular Formula | C13H9ClO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 206.349ºC |
|---|
Names
| Name | Benzoic acid, 4-chloro-, 4-hydroxyphenyl ester |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.357g/cm3 |
|---|
| Boiling Point | 417.586ºC at 760 mmHg |
|---|
| Molecular Formula | C13H9ClO3 |
|---|
| Molecular Weight | 248.66200 |
|---|
| Flash Point | 206.349ºC |
|---|
| Exact Mass | 248.02400 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 3.26480 |
|---|
| Index of Refraction | 1.624 |
|---|
| InChIKey | QODPSUCGKVLBCA-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Oc1ccc(O)cc1)c1ccc(Cl)cc1 |
|---|
Synonyms
| O-(4-chlorobenzoyl)hydroquinone |
| 4-Chlor-benzoesaeure-(3-trifluormethyl-anilid) |
| 4-Chlor-benzoesaeure-(4-hydroxy-phenylester) |
| 4-chlorobenzoic acid 4-hydroxyphenyl ester |
| 4-chloro-benzoic acid-(3-trifluoromethyl-anilide) |
