Introduction：Basic information about CAS 68162-09-4|4-(n-Decyloxy)benzoic acid,4-(n-hexyloxy)phenyl ether, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(n-Decyloxy)benzoic acid,4-(n-hexyloxy)phenyl ether |
|---|
| CAS Number | 68162-09-4 | Molecular Weight | 454.64100 |
|---|
| Density | 1.005g/cm3 | Boiling Point | 567.2ºC at 760 mmHg |
|---|
| Molecular Formula | C29H42O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 238ºC |
|---|
Names
| Name | (4-hexoxyphenyl) 4-decoxybenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.005g/cm3 |
|---|
| Boiling Point | 567.2ºC at 760 mmHg |
|---|
| Molecular Formula | C29H42O4 |
|---|
| Molecular Weight | 454.64100 |
|---|
| Flash Point | 238ºC |
|---|
| Exact Mass | 454.30800 |
|---|
| PSA | 44.76000 |
|---|
| LogP | 8.38440 |
|---|
| Index of Refraction | 1.514 |
|---|
| InChIKey | JBMARNOUPBCWIL-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Oc2ccc(OCCCCCC)cc2)cc1 |
|---|
Synonyms
| 4-n-decyloxy-(4'-n-hexyloxyphenyl)-benzoate |
| 4-(Hexyloxy)phenyl 4-(decyloxy)benzoate |
| p-n-Decyloxybenzoesaeure-p-n-hexyloxyphenylester |
| HMS640D09 |
| F0347-1402 |
| 4-(n-Decyloxy)benzoic acid,4-(n-hexyloxy)phenyl ether |
