Introduction:Basic information about CAS 51338-26-2|Propanoic acid, 2-(4-phenoxyphenoxy)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Propanoic acid, 2-(4-phenoxyphenoxy)- |
|---|
| CAS Number | 51338-26-2 | Molecular Weight | 258.26900 |
|---|
| Density | 1.218g/cm3 | Boiling Point | 405.9ºC at 760 mmHg |
|---|
| Molecular Formula | C15H14O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 151.2ºC |
|---|
Names
| Name | Propanoic acid, 2-(4-phenoxyphenoxy) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.218g/cm3 |
|---|
| Boiling Point | 405.9ºC at 760 mmHg |
|---|
| Molecular Formula | C15H14O4 |
|---|
| Molecular Weight | 258.26900 |
|---|
| Flash Point | 151.2ºC |
|---|
| Exact Mass | 258.08900 |
|---|
| PSA | 55.76000 |
|---|
| LogP | 3.33080 |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | GQJSEWJUWSSORX-UHFFFAOYSA-N |
|---|
| SMILES | CC(Oc1ccc(Oc2ccccc2)cc1)C(=O)O |
|---|
Safety Information
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| o-(1-Propylpentyl)phenol |
| 2-(4-Octyl)phenol |
| o-(4-octyl)phenol |
| 4-(2-Hydroxyphenyl)octane |
| 2-(1-Propylpentyl)-phenol |
| 2-(4-Phenoxy-phenoxy)-propionsaeure |
| Phenol,2-(1-propylpentyl) |
| o-(1-Propylamyl)phenol |
| 2-(4-phenoxy-phenoxy)-propionic acid |
| O-(4-Phenoxy-phenyl)-DL-milchsaeure |