Introduction：Basic information about CAS 53880-86-7|Dimethyldiphenylthiuram disulfide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dimethyldiphenylthiuram disulfide |
|---|
| CAS Number | 53880-86-7 | Molecular Weight | 364.572 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 499.1±48.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H16N2S4 | Melting Point | 180ºC (Min.) |
|---|
| MSDS | / | Flash Point | 255.6±29.6 °C |
|---|
Names
| Name | (4-methylphenyl)carbamothioylsulfanyl N-(4-methylphenyl)carbamodithioate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 499.1±48.0 °C at 760 mmHg |
|---|
| Melting Point | 180ºC (Min.) |
|---|
| Molecular Formula | C16H16N2S4 |
|---|
| Molecular Weight | 364.572 |
|---|
| Flash Point | 255.6±29.6 °C |
|---|
| Exact Mass | 364.019623 |
|---|
| PSA | 121.26000 |
|---|
| LogP | 6.40 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.789 |
|---|
| InChIKey | DKIOSBCZGFSSFK-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(NC(=S)SSC(=S)Nc2ccc(C)cc2)cc1 |
|---|
Synonyms
| Thioperoxydicarbonic diamide (((H2N)C(S))2S2),dimethyldiphenyl |
| Benzene, 1-methyl-4-[[[[[(4-methylphenyl)amino]thioxomethyl]dithio]thioxomethyl]amino]- |
| Dimethyldiphenylthiuram disulfide |
| 1-Methyl-4-[({[(4-methylphenyl)carbamothioyl]disulfanyl}carbonothioyl)amino]benzene |
| EINECS 258-835-3 |
| Dimethyldiphenylthioperoxydicarbamic acid |
