Introduction：Basic information about CAS 904814-87-5|4-(2-carboxy-6-nitro-phenyl)-piperazine-1-carboxylic acid tertier-butyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(2-carboxy-6-nitro-phenyl)-piperazine-1-carboxylic acid tertier-butyl ester |
|---|
| CAS Number | 904814-87-5 | Molecular Weight | 351.35400 |
|---|
| Density | 1.329g/cm3 | Boiling Point | 511.1ºC at 760mmHg |
|---|
| Molecular Formula | C16H21N3O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 262.9ºC |
|---|
Names
| Name | 4-(2-carboxy-6-nitro-phenyl)-piperazine-1-carboxylic acid tertier-butyl ester |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.329g/cm3 |
|---|
| Boiling Point | 511.1ºC at 760mmHg |
|---|
| Molecular Formula | C16H21N3O6 |
|---|
| Molecular Weight | 351.35400 |
|---|
| Flash Point | 262.9ºC |
|---|
| Exact Mass | 351.14300 |
|---|
| PSA | 115.90000 |
|---|
| LogP | 2.87620 |
|---|
| Index of Refraction | 1.582 |
|---|
| InChIKey | DBHWLMWTRSFATJ-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCN(c2c(C(=O)O)cccc2[N+](=O)[O-])CC1 |
|---|
Synonyms
| 4-(2-carboxy-6-nitro-phenyl)-piperazine-1-carboxylic acid tert-butyl ester |
