Introduction：Basic information about CAS 912762-33-5|[2-(3-methoxy-phenyl)-2-oxo-ethyl]-carbamic acid tert-butyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [2-(3-methoxy-phenyl)-2-oxo-ethyl]-carbamic acid tert-butyl ester |
|---|
| CAS Number | 912762-33-5 | Molecular Weight | 265.30500 |
|---|
| Density | 1.106g/cm3 | Boiling Point | 403.7ºC at 760 mmHg |
|---|
| Molecular Formula | C14H19NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 198ºC |
|---|
Names
| Name | [2-(3-methoxy-phenyl)-2-oxo-ethyl]-carbamic acid tert-butyl ester |
|---|
Chemical & Physical Properties
| Density | 1.106g/cm3 |
|---|
| Boiling Point | 403.7ºC at 760 mmHg |
|---|
| Molecular Formula | C14H19NO4 |
|---|
| Molecular Weight | 265.30500 |
|---|
| Flash Point | 198ºC |
|---|
| Exact Mass | 265.13100 |
|---|
| PSA | 64.63000 |
|---|
| LogP | 2.79350 |
|---|
| Index of Refraction | 1.507 |
|---|
| InChIKey | WVEMSQHRMOUOBW-UHFFFAOYSA-N |
|---|
| SMILES | COc1cccc(C(=O)CNC(=O)OC(C)(C)C)c1 |
|---|
