Introduction:Basic information about CAS 85068-32-2|3,5-Di(trifluoromethyl)benzyl cyanide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,5-Di(trifluoromethyl)benzyl cyanide |
|---|
| CAS Number | 85068-32-2 | Molecular Weight | 253.144 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 195.4±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H5F6N | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 71.9±25.9 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 3,5-Bis(Trifluoromethyl)Phenylacetonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 195.4±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H5F6N |
|---|
| Molecular Weight | 253.144 |
|---|
| Flash Point | 71.9±25.9 °C |
|---|
| Exact Mass | 253.032623 |
|---|
| PSA | 23.79000 |
|---|
| LogP | 2.87 |
|---|
| Vapour Pressure | 0.4±0.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.414 |
|---|
| InChIKey | YXGWYBUKRTYHJM-UHFFFAOYSA-N |
|---|
| SMILES | N#CCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302 + H312 + H332-H315-H319-H335 |
|---|
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | Xn:Harmful; |
|---|
| Risk Phrases | R20/21/22;R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| RIDADR | 3276 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 2926909090 |
|---|
Customs
| HS Code | 2926909090 |
|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-[3,5-bis(trifluoromethyl)phenyl]acetonitrile |
| 5-(Cyanomethyl)-α,α,α,α',α',α'-hexafluoro-m-xylene |
| [3,5-Bis(trifluoromethyl)phenyl]acetonitrile |
| 3,5-Di(trifluoromethyl)benzyl cyanide |
| FXFFR C1CN EXFFF |
| 3,5-Bis(trifluoromethyl)benzyl cyanide |
| MFCD00009904 |
| 3,5-Bis(trifluoromethyl)phenylacetonitrile |
| EINECS 285-294-0 |
| 2-[3,5-Bis(trifluoromethyl)phenyl]acetonitrile[ |
| 3,5-Bis(trifluoromethyl)benzeneacetonitrile |
| Benzeneacetonitrile, 3,5-bis(trifluoromethyl)- |