Introduction：Basic information about CAS 400-98-6|4-Amino-3-nitrobenzo trifluoride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Amino-3-nitrobenzo trifluoride |
|---|
| CAS Number | 400-98-6 | Molecular Weight | 206.122 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 265.6±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H5F3N2O2 | Melting Point | 105-106 °C(lit.) |
|---|
| MSDS | USA | Flash Point | 114.4±27.3 °C |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-Amino-3-nitrobenzotrifluoride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 265.6±40.0 °C at 760 mmHg |
|---|
| Melting Point | 105-106 °C(lit.) |
|---|
| Molecular Formula | C7H5F3N2O2 |
|---|
| Molecular Weight | 206.122 |
|---|
| Flash Point | 114.4±27.3 °C |
|---|
| Exact Mass | 206.030319 |
|---|
| PSA | 71.84000 |
|---|
| LogP | 2.94 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.525 |
|---|
| InChIKey | ATXBGHLILIABGX-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H312-H315-H319-H332-H335 |
|---|
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn:Harmful; |
|---|
| Risk Phrases | R20/21/22;R36/37/38 |
|---|
| Safety Phrases | S26-S36/37 |
|---|
| RIDADR | UN2811 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 2921420090 |
|---|
Customs
| HS Code | 2921420090 |
|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 3-NITRO-A,A,A-TRIFLUORO-P-TOLUIDINE |
| 4-trifluoromethyl-2-nitroaniline |
| α,α,α-Trifluoro-2-nitro-p-toluidine |
| Benzenamine, 2-nitro-4-(trifluoromethyl)- |
| 3-NITRO-4-AMINOBENZOTRIFLUORIDE |
| p-Toluidine, α,α,α-trifluoro-2-nitro- |
| Aniline, 2-nitro-4-trifluoromethyl- |
| 2-Nitro-4-(trifluoromethyl)aniline |
| 4-Amino-3-nitrobenzo trifluoride |
| 2-NITRO-A,A,A-TRIFLUORO-P-TOLUIDINE |
| Benzenamine, 2-nitro-4- (trifluoromethyl)- |
| MFCD00007155 |
| EINECS 206-926-3 |
