Introduction：Basic information about CAS 433-98-7|Benzenesulfonylfluoride, 2-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenesulfonylfluoride, 2-nitro- |
|---|
| CAS Number | 433-98-7 | Molecular Weight | 205.16400 |
|---|
| Density | 1.554g/cm3 | Boiling Point | 306ºC at 760mmHg |
|---|
| Molecular Formula | C6H4FNO4S | Melting Point | 56-60 ℃ |
|---|
| MSDS | ChineseUSA | Flash Point | 138.9ºC |
|---|
| Symbol |
GHS05 | Signal Word | Danger |
|---|
Names
| Name | 2-nitrobenzenesulfonyl fluoride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.554g/cm3 |
|---|
| Boiling Point | 306ºC at 760mmHg |
|---|
| Melting Point | 56-60 ℃ |
|---|
| Molecular Formula | C6H4FNO4S |
|---|
| Molecular Weight | 205.16400 |
|---|
| Flash Point | 138.9ºC |
|---|
| Exact Mass | 204.98500 |
|---|
| PSA | 88.34000 |
|---|
| LogP | 2.85700 |
|---|
| Vapour Pressure | 0.00143mmHg at 25°C |
|---|
| Index of Refraction | 1.544 |
|---|
| InChIKey | HSQIQAVSSNKMBM-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)F |
|---|
Safety Information
| Symbol |
GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Hazard Codes | C |
|---|
| Risk Phrases | 34 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| RIDADR | UN 3261 |
|---|
| Packaging Group | III |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| o-Nitrobenzenesulfonyl fluoride |
| 2-nitrophenylsulfonylfluoride |
| o-Nitrobenzolsulfofluorid |
| 2-Nitrobenzenesulphonyl fluoride |
| 2-Nitro-benzenesulfonyl fluoride |
| 2-Nitro-benzolsulfonylfluorid |
| o-Nitrobenzolsulfonylfluorid |
