Introduction:Basic information about CAS 902836-49-1|4-[2-(Trifluoromethoxy)Phenoxy]Piperidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[2-(Trifluoromethoxy)Phenoxy]Piperidine |
|---|
| CAS Number | 902836-49-1 | Molecular Weight | 261.24000 |
|---|
| Density | 1.23 | Boiling Point | 275ºC |
|---|
| Molecular Formula | C12H14F3NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 120ºC |
|---|
Names
| Name | 4-(2-(Trifluoromethoxy)phenoxy)piperidine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.23 |
|---|
| Boiling Point | 275ºC |
|---|
| Molecular Formula | C12H14F3NO2 |
|---|
| Molecular Weight | 261.24000 |
|---|
| Flash Point | 120ºC |
|---|
| Exact Mass | 261.09800 |
|---|
| PSA | 30.49000 |
|---|
| LogP | 3.04480 |
|---|
| Index of Refraction | 1.475 |
|---|
| InChIKey | UXSFSVYZILNPEV-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)Oc1ccccc1OC1CCNCC1 |
|---|
Synonyms
| 4-[2-(trifluoromethoxy)phenoxy]piperidine |