Introduction：Basic information about CAS 3010-81-9|4,4',4''-TRIMETHOXYTRITYL ALCOHOL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4',4''-TRIMETHOXYTRITYL ALCOHOL |
|---|
| CAS Number | 3010-81-9 | Molecular Weight | 350.40800 |
|---|
| Density | 1.159g/cm3 | Boiling Point | 522.1ºC at 760mmHg |
|---|
| Molecular Formula | C22H22O4 | Melting Point | 76-77ºC |
|---|
| MSDS | / | Flash Point | 269.6ºC |
|---|
Names
| Name | tris(4-methoxyphenyl)methanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.159g/cm3 |
|---|
| Boiling Point | 522.1ºC at 760mmHg |
|---|
| Melting Point | 76-77ºC |
|---|
| Molecular Formula | C22H22O4 |
|---|
| Molecular Weight | 350.40800 |
|---|
| Flash Point | 269.6ºC |
|---|
| Exact Mass | 350.15200 |
|---|
| PSA | 47.92000 |
|---|
| LogP | 3.99660 |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | JCLOLVVCZNYDIP-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C(O)(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
|---|
Safety Information
| Safety Phrases | S22-S24/25 |
|---|
| HS Code | 2909499000 |
|---|
Customs
| HS Code | 2909499000 |
|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
|---|
Synonyms
| Hydroxy-tris-(4-methoxy-phenyl)-methan |
| Tris(4-methoxyphenyl)methanol |
| tri(4-methoxyphenyl)methanol |
| 4,4',4''-trimethoxytrityl alcohol |
| EINECS 221-139-5 |
| tri(p-anisyl)methanol |
| Tris-(4-methoxy-phenyl)-methanol |
| tri(4-methoxyphenyl)carbinol |
