Introduction：Basic information about CAS 15644-80-1|2,8-Dimethylchinolin-4-ol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,8-Dimethylchinolin-4-ol |
|---|
| CAS Number | 15644-80-1 | Molecular Weight | 173.211 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 292.4±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H11NO | Melting Point | 262.3°C |
|---|
| MSDS | ChineseUSA | Flash Point | 124.9±27.5 °C |
|---|
| Symbol |
GHS05, GHS07 | Signal Word | Danger |
|---|
Names
| Name | 2,8-Dimethyl-4-hydroxyquinoline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 292.4±40.0 °C at 760 mmHg |
|---|
| Melting Point | 262.3°C |
|---|
| Molecular Formula | C11H11NO |
|---|
| Molecular Weight | 173.211 |
|---|
| Flash Point | 124.9±27.5 °C |
|---|
| Exact Mass | 173.084061 |
|---|
| PSA | 33.12000 |
|---|
| LogP | 3.55 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.567 |
|---|
| InChIKey | QUHJYDMHDWSZIP-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(=O)c2cccc(C)c2[nH]1 |
|---|
Safety Information
| Symbol |
GHS05, GHS07 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H302-H318 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338 |
|---|
| Risk Phrases | 22-41 |
|---|
| Safety Phrases | 26-39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 2,8-Dimethyl-4-hydroxyquinoline |
| 2,8-Dimethylquinolin-4(1H)-one |
| 2,8-Dimethyl-4(1H)-quinolinone |
| 2,8-dimethylquinolin-4-ol |
| 4-Quinolinol, 2,8-dimethyl- |
| 2,8-Dimethylchinolin-4-ol |
| 4(1H)-Quinolinone, 2,8-dimethyl- |
