Introduction：Basic information about CAS 203626-57-7|5,8-DIMETHYL-4-QUINOLINOL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,8-DIMETHYL-4-QUINOLINOL |
|---|
| CAS Number | 203626-57-7 | Molecular Weight | 173.21100 |
|---|
| Density | 1.12g/cm3 | Boiling Point | 303.3ºC at 760 mmHg |
|---|
| Molecular Formula | C11H11NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 131.1ºC |
|---|
Names
| Name | 5,8-dimethyl-1H-quinolin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.12g/cm3 |
|---|
| Boiling Point | 303.3ºC at 760 mmHg |
|---|
| Molecular Formula | C11H11NO |
|---|
| Molecular Weight | 173.21100 |
|---|
| Flash Point | 131.1ºC |
|---|
| Exact Mass | 173.08400 |
|---|
| PSA | 33.12000 |
|---|
| LogP | 2.55720 |
|---|
| Vapour Pressure | 0.000937mmHg at 25°C |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | JLOYAQFVPXIJKV-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C)c2c(=O)cc[nH]c12 |
|---|
Synonyms
| 5,8-Dimethyl-4-quinolinol |
| 5,8-dimethyl-4-quinolone |
| 5,8-Dimethyl-4-hydroxyquinoline |
| 5,8-Dimethylquinolin-4-ol |
