Introduction:Basic information about CAS 402568-10-9|ethyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-oxoacetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-oxoacetate |
|---|
| CAS Number | 402568-10-9 | Molecular Weight | 314.18100 |
|---|
| Density | 1.399g/cm3 | Boiling Point | 276.3ºC at 760mmHg |
|---|
| Molecular Formula | C12H8F6O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 117.2ºC |
|---|
Names
| Name | ethyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-oxoacetate |
|---|
Chemical & Physical Properties
| Density | 1.399g/cm3 |
|---|
| Boiling Point | 276.3ºC at 760mmHg |
|---|
| Molecular Formula | C12H8F6O3 |
|---|
| Molecular Weight | 314.18100 |
|---|
| Flash Point | 117.2ºC |
|---|
| Exact Mass | 314.03800 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 3.47000 |
|---|
| Index of Refraction | 1.424 |
|---|
| InChIKey | ZOKKCCACHYBHRS-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|