Introduction：Basic information about CAS 574-77-6|papaveroline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | papaveroline |
|---|
| CAS Number | 574-77-6 | Molecular Weight | 283.27900 |
|---|
| Density | 1.52g/cm3 | Boiling Point | 634ºC at 760mmHg |
|---|
| Molecular Formula | C16H13NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 337.2ºC |
|---|
Names
| Name | papaveroline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.52g/cm3 |
|---|
| Boiling Point | 634ºC at 760mmHg |
|---|
| Molecular Formula | C16H13NO4 |
|---|
| Molecular Weight | 283.27900 |
|---|
| Flash Point | 337.2ºC |
|---|
| Exact Mass | 283.08400 |
|---|
| PSA | 93.81000 |
|---|
| LogP | 2.64800 |
|---|
| Index of Refraction | 1.772 |
|---|
| InChIKey | MXQKCNCLQIHHJA-UHFFFAOYSA-N |
|---|
| SMILES | Oc1ccc(Cc2nccc3cc(O)c(O)cc23)cc1O |
|---|
Synonyms
| Papaverolina |
| Papaverolinum |
| desmethylpapverine |
