Introduction：Basic information about CAS 90895-85-5|Ronactolol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ronactolol |
|---|
| CAS Number | 90895-85-5 | Molecular Weight | 358.43100 |
|---|
| Density | 1.171g/cm3 | Boiling Point | 477.6ºC at 760mmHg |
|---|
| Molecular Formula | C20H26N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 242.6ºC |
|---|
Names
| Name | N-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-4-methoxybenzamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.171g/cm3 |
|---|
| Boiling Point | 477.6ºC at 760mmHg |
|---|
| Molecular Formula | C20H26N2O4 |
|---|
| Molecular Weight | 358.43100 |
|---|
| Flash Point | 242.6ºC |
|---|
| Exact Mass | 358.18900 |
|---|
| PSA | 79.82000 |
|---|
| LogP | 3.14910 |
|---|
| Index of Refraction | 1.584 |
|---|
| InChIKey | BPNZFFWEUGGXMC-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C(=O)Nc2ccc(OCC(O)CNC(C)C)cc2)cc1 |
|---|
Synonyms
| UNII-PJ691WQY08 |
| Ronactolol |
| Ronactololum |
