Introduction：Basic information about CAS 55165-22-5|Butocrolol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Butocrolol |
|---|
| CAS Number | 55165-22-5 | Molecular Weight | 361.38900 |
|---|
| Density | 1.289g/cm3 | Boiling Point | 462.4ºC at 760 mmHg |
|---|
| Molecular Formula | C19H23NO6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 233.4ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.289g/cm3 |
|---|
| Boiling Point | 462.4ºC at 760 mmHg |
|---|
| Molecular Formula | C19H23NO6 |
|---|
| Molecular Weight | 361.38900 |
|---|
| Flash Point | 233.4ºC |
|---|
| Exact Mass | 361.15300 |
|---|
| PSA | 105.07000 |
|---|
| LogP | 3.07190 |
|---|
| Index of Refraction | 1.601 |
|---|
| InChIKey | RRTGJSZJWLUVRE-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(=O)c2c(O)c3ccoc3c(OCC(O)CNC(C)(C)C)c2o1 |
|---|
