Introduction:Basic information about CAS 355-41-9|1-chloro-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane |
|---|
| CAS Number | 355-41-9 | Molecular Weight | 354.49600 |
|---|
| Density | 1.687g/cm3 | Boiling Point | 87.4ºC at 760mmHg |
|---|
| Molecular Formula | C6ClF13 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 24.5ºC |
|---|
Names
| Name | 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.687g/cm3 |
|---|
| Boiling Point | 87.4ºC at 760mmHg |
|---|
| Molecular Formula | C6ClF13 |
|---|
| Molecular Weight | 354.49600 |
|---|
| Flash Point | 24.5ºC |
|---|
| Exact Mass | 353.94800 |
|---|
| LogP | 4.92150 |
|---|
| Index of Refraction | 1.278 |
|---|
| InChIKey | BDUCYIFEYLMINO-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| HS Code | 2903799090 |
|---|
Customs
| HS Code | 2903799090 |
|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| EINECS 206-584-5 |
| n-perfluorohexyl chloride |
| chloro-1 perfluorohexane |
| 1-chloro-tridecafluoro-hexane |
| PC6086 |
| Perfluorohexyl chloride |
| 1-Chlor-tridecafluor-hexan |
| chloroperfluorohexane |