Introduction：Basic information about CAS 40332-25-0|N-[(2-Methyl-1H-benzimidazol-1-yl)acetyl]-L-phenylalanine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[(2-Methyl-1H-benzimidazol-1-yl)acetyl]-L-phenylalanine |
|---|
| CAS Number | 40332-25-0 | Molecular Weight | 351.39900 |
|---|
| Density | 1.27 | Boiling Point | 596.5ºC at 760mmHg |
|---|
| Molecular Formula | C20H21N3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 314.6ºC |
|---|
Names
| Name | methyl (2S)-2-[[2-(2-methylbenzimidazol-1-yl)acetyl]amino]-3-phenylpropanoate |
|---|
Chemical & Physical Properties
| Density | 1.27 |
|---|
| Boiling Point | 596.5ºC at 760mmHg |
|---|
| Molecular Formula | C20H21N3O3 |
|---|
| Molecular Weight | 351.39900 |
|---|
| Flash Point | 314.6ºC |
|---|
| Exact Mass | 351.15800 |
|---|
| PSA | 73.22000 |
|---|
| LogP | 2.63610 |
|---|
| Index of Refraction | 1.608 |
|---|
| InChIKey | JRBYMRQNQUJCFN-KRWDZBQOSA-N |
|---|
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)Cn1c(C)nc2ccccc21 |
|---|
