Introduction：Basic information about CAS 15596-07-3|(Triphenylphosphoranylidene)ketene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (Triphenylphosphoranylidene)ketene |
|---|
| CAS Number | 15596-07-3 | Molecular Weight | 302.30600 |
|---|
| Density | 1.12g/cm3 | Boiling Point | 455.4ºC at 760 mmHg |
|---|
| Molecular Formula | C20H15OP | Melting Point | 171ºC |
|---|
| MSDS | / | Flash Point | 229.2ºC |
|---|
Names
| Name | (Triphenylphosphoranylidene)ketene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.12g/cm3 |
|---|
| Boiling Point | 455.4ºC at 760 mmHg |
|---|
| Melting Point | 171ºC |
|---|
| Molecular Formula | C20H15OP |
|---|
| Molecular Weight | 302.30600 |
|---|
| Flash Point | 229.2ºC |
|---|
| Exact Mass | 302.08600 |
|---|
| PSA | 26.88000 |
|---|
| LogP | 2.76940 |
|---|
| Vapour Pressure | 1.77E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.604 |
|---|
| InChIKey | MNASRBWCHRURHY-UHFFFAOYSA-N |
|---|
| SMILES | O=C=C=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
|---|
Synonyms
| Bestmann Ylide |
| Ketenylidene(triphenyl)phosphorane |
| Bestmann reagent |
| Bestmann's ylide |
| (Triphenylphosphoranylidene)ethenone,Bestmann ylide,Ketenylidene(triphenyl)phosphorane |
| Ketenylidene(triphenyl)phosphoraneBestmann Ylide |
