Introduction：Basic information about CAS 152460-07-6|(2-methyl-5-nitrophenyl) nitrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2-methyl-5-nitrophenyl) nitrate |
|---|
| CAS Number | 152460-07-6 | Molecular Weight | 194.19100 |
|---|
| Density | 1.432g/cm3 | Boiling Point | 426.748ºC at 760 mmHg |
|---|
| Molecular Formula | C8H10N4O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 211.89ºC |
|---|
Names
| Name | (2-methyl-5-nitrophenyl) nitrate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.432g/cm3 |
|---|
| Boiling Point | 426.748ºC at 760 mmHg |
|---|
| Molecular Formula | C8H10N4O2 |
|---|
| Molecular Weight | 194.19100 |
|---|
| Flash Point | 211.89ºC |
|---|
| Exact Mass | 194.08000 |
|---|
| PSA | 107.72000 |
|---|
| LogP | 2.60480 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.646 |
|---|
| InChIKey | LAZBONZCMJREIQ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc([N+](=O)[O-])cc1N=C(N)N |
|---|
Synonyms
| Guanidine,(2-methyl-5-nitrophenyl)-(9CI) |
| 1-(2-methyl-5-nitrophenyl)guanidine |
| N-(2-Methyl-5-nitro-phenyl)-guanidine |
| Guanidine,N-(2-methyl-5-nitrophenyl) |
| (2-methyl-5-nitrophenyl)guanidine |
