Introduction:Basic information about CAS 90536-66-6|4-Methylsulfonyl phenyl acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Methylsulfonyl phenyl acetic acid |
|---|
| CAS Number | 90536-66-6 | Molecular Weight | 214.238 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 443.0±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H10O4S | Melting Point | 136-140 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 221.7±26.5 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-(Methylsulfonyl)phenylacetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 443.0±37.0 °C at 760 mmHg |
|---|
| Melting Point | 136-140 °C(lit.) |
|---|
| Molecular Formula | C9H10O4S |
|---|
| Molecular Weight | 214.238 |
|---|
| Flash Point | 221.7±26.5 °C |
|---|
| Exact Mass | 214.029984 |
|---|
| PSA | 79.82000 |
|---|
| LogP | -0.21 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.557 |
|---|
| InChIKey | HGGWOSYNRVOQJH-UHFFFAOYSA-N |
|---|
| SMILES | CS(=O)(=O)c1ccc(CC(=O)O)cc1 |
|---|
| Water Solubility | slight |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H319 |
|---|
| Precautionary Statements | P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36 |
|---|
| Safety Phrases | S26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| [4-(Methylsulfonyl)phenyl]acetic acid |
| Benzeneacetic acid, 4-(methylsulfonyl)- |
| 2-(4-methylsulfonylphenyl)acetic acid |
| 2-[4-(methylsulfonyl)phenyl]acetic acid |
| 4-Methylsulfonylphenylacetic acid |
| MFCD00216495 |
| 4-Methylsulfonyl phenyl acetic acid |
| Etoricoxib Impurity 3 |