Introduction:Basic information about CAS 99156-45-3|potassium,3,4,5-trihydroxy-6-[(13-methyl-17-sulfooxy-6,7,8,9,11,12,14,15,16,17-decahy, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | potassium,3,4,5-trihydroxy-6-[(13-methyl-17-sulfooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl)oxy]oxane-2-carboxylic acid |
|---|
| CAS Number | 99156-45-3 | Molecular Weight | 604.75000 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C24H30K2O11S | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol | GHS07, GHS08 | Signal Word | Warning |
|---|
Names
| Name | potassium,3,4,5-trihydroxy-6-[(13-methyl-17-sulfooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl)oxy]oxane-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C24H30K2O11S |
|---|
| Molecular Weight | 604.75000 |
|---|
| Exact Mass | 604.07800 |
|---|
| PSA | 194.09000 |
|---|
| LogP | 0.40520 |
|---|
| InChIKey | VNSWOHHNKXNEBZ-UHFFFAOYSA-N |
|---|
| SMILES | CC12CCC3c4ccc(OC5OC(C(=O)O)C(O)C(O)C5O)cc4CCC3C1CCC2OS(=O)(=O)O.[K] |
|---|
Safety Information
| Symbol | GHS07, GHS08 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H312-H332-H351 |
|---|
| Precautionary Statements | P280 |
|---|
| Personal Protective Equipment | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
|---|
| Hazard Codes | Xn |
|---|
| Risk Phrases | R40;R20/21/22 |
|---|
| Safety Phrases | S22;S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| MFCD00056533 |
| 1,3,5(10)-Estratriene-3,17|A-diol 3-glucuronide 17-sulfate |
| 3,17beta-Dihydroxy-1,3,5(10)-estratriene 3-glucuronide 17-sulfate |
| 3,17|A-Dihydroxy-1,3,5(10)-estratriene 3-glucuronide 17-sulfate |
| 1,3,5(10)-Estratriene-3,17beta-diol 3-glucuronide 17-sulfate |
| |A-Estradiol 3-(|A-D-glucuronide) 17-sulfate dipotassium salt |