Introduction：Basic information about CAS 5428-43-3|Acetamide,2-chloro-N,N-diphenyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Acetamide,2-chloro-N,N-diphenyl- |
|---|
| CAS Number | 5428-43-3 | Molecular Weight | 245.70400 |
|---|
| Density | 1.234g/cm3 | Boiling Point | 441.6ºC at 760mmHg |
|---|
| Molecular Formula | C14H12ClNO | Melting Point | 119-121ºC |
|---|
| MSDS | / | Flash Point | 220.8ºC |
|---|
Names
| Name | 2-Chloro-N,N-diphenylacetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.234g/cm3 |
|---|
| Boiling Point | 441.6ºC at 760mmHg |
|---|
| Melting Point | 119-121ºC |
|---|
| Molecular Formula | C14H12ClNO |
|---|
| Molecular Weight | 245.70400 |
|---|
| Flash Point | 220.8ºC |
|---|
| Exact Mass | 245.06100 |
|---|
| PSA | 20.31000 |
|---|
| LogP | 3.59010 |
|---|
| InChIKey | GRIXINIGTYIHSN-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CCl)N(c1ccccc1)c1ccccc1 |
|---|
Safety Information
| Hazard Codes | C |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N,N-diphenylchloroacetic amide |
| chlorodiphenylacetamide |
| 2-Chlor-N,N-diphenylacetamid |
| 2-chloro-N,N-diphenylethanamide |
| N,N-diphenylchloroacetamide |
| 1-(diphenylamino)-2-chloro-ethan-1-one |
| n,n-diphenyl 2-chloroacetamide |
