Introduction：Basic information about CAS 733-07-3|Benzene,1,3,5-trimethyl-2-[(2,4,6-trimethylphenyl)methyl]-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzene,1,3,5-trimethyl-2-[(2,4,6-trimethylphenyl)methyl]- |
|---|
| CAS Number | 733-07-3 | Molecular Weight | 252.39400 |
|---|
| Density | 0.947g/cm3 | Boiling Point | 370.7ºC at 760 mmHg |
|---|
| Molecular Formula | C19H24 | Melting Point | 132-135ºC |
|---|
| MSDS | / | Flash Point | 192.8ºC |
|---|
Names
| Name | 1,3,5-trimethyl-2-[(2,4,6-trimethylphenyl)methyl]benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.947g/cm3 |
|---|
| Boiling Point | 370.7ºC at 760 mmHg |
|---|
| Melting Point | 132-135ºC |
|---|
| Molecular Formula | C19H24 |
|---|
| Molecular Weight | 252.39400 |
|---|
| Flash Point | 192.8ºC |
|---|
| Exact Mass | 252.18800 |
|---|
| LogP | 5.12780 |
|---|
| Index of Refraction | 1.547 |
|---|
| InChIKey | ZQYQPPLKPFBKLD-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)c(Cc2c(C)cc(C)cc2C)c(C)c1 |
|---|
Safety Information
Synonyms
| 1,1'-Methylenebis(2,4,6-trimethylbenzene) |
| dimesityl-methane |
| Benzene,1'-methylenebis[2,4,6-trimethyl |
| EINECS 211-991-6 |
| MFCD00014913 |
| bis(mesityl)methane |
| Benzene,1,1'-methylenebis[2,4,6-trimethyl |
| bis(2,4,6-trimethylphenyl)methane |
| Dimesitylmethan |
