Introduction：Basic information about CAS 216393-56-5|3-[tert-butyl(dimethyl)silyl]oxybenzenethiol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-[tert-butyl(dimethyl)silyl]oxybenzenethiol |
|---|
| CAS Number | 216393-56-5 | Molecular Weight | 240.43700 |
|---|
| Density | 0.983g/cm3 | Boiling Point | 270.2ºC at 760mmHg |
|---|
| Molecular Formula | C12H20OSSi | Melting Point | / |
|---|
| MSDS | / | Flash Point | 117.2ºC |
|---|
Names
| Name | 3-[tert-butyl(dimethyl)silyl]oxybenzenethiol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.983g/cm3 |
|---|
| Boiling Point | 270.2ºC at 760mmHg |
|---|
| Molecular Formula | C12H20OSSi |
|---|
| Molecular Weight | 240.43700 |
|---|
| Flash Point | 117.2ºC |
|---|
| Exact Mass | 240.10000 |
|---|
| PSA | 48.03000 |
|---|
| LogP | 4.35930 |
|---|
| Vapour Pressure | 0.012mmHg at 25°C |
|---|
| Index of Refraction | 1.521 |
|---|
| InChIKey | KRHCTXFJCFMFOR-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)[Si](C)(C)Oc1cccc(S)c1 |
|---|
Safety Information
| Risk Phrases | R36/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | UN 3335 |
|---|
Synonyms
| 3-(tert-Butyldimethylsiloxy)benzenethiol |
| 3-{[(1,1-dimethylethyl)(dimethyl)silyl]oxy}benzenethiol |
| 3-(tertiary-butyldimethylsiloxy)thiophenol |
| 3-(t-butyl-dimethyl-silanyloxy)-benzenethiol |
| Benzenethiol,3-[[(1,1-dimethylethyl)dimethylsilyl]oxy] |
| 3-(TERT-BUTYLDIMETHYLSILOXY)THIOPHENOL |
| 3-tert-Butyldimethylsilyloxythiophenol |
| MFCD01318115 |
