Introduction：Basic information about CAS 119692-41-0|2-methoxy-6-(trifluoromethyl)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-methoxy-6-(trifluoromethyl)benzoic acid |
|---|
| CAS Number | 119692-41-0 | Molecular Weight | 220.14500 |
|---|
| Density | 1.38g/cm3 | Boiling Point | 276.2ºC at 760mmHg |
|---|
| Molecular Formula | C9H7F3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 120.8ºC |
|---|
Names
| Name | 2-methoxy-6-(trifluoromethyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.38g/cm3 |
|---|
| Boiling Point | 276.2ºC at 760mmHg |
|---|
| Molecular Formula | C9H7F3O3 |
|---|
| Molecular Weight | 220.14500 |
|---|
| Flash Point | 120.8ºC |
|---|
| Exact Mass | 220.03500 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 2.41220 |
|---|
| Vapour Pressure | 0.002mmHg at 25°C |
|---|
| Index of Refraction | 1.474 |
|---|
| InChIKey | IOJYMQXQDCJQBF-UHFFFAOYSA-N |
|---|
| SMILES | COc1cccc(C(F)(F)F)c1C(=O)O |
|---|
Synonyms
| Benzoic acid,2-methoxy-6-(trifluoromethyl) |
| 2-Methoxy-6-trifluoromethyl-benzosaure |
| 6-methoxy-2-trifluoromethylbenzoic acid |
| PC5505 |
