Introduction：Basic information about CAS 127346-42-3|2-methylsulfanyl-5-nitro-1,3-thiazol-4-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-methylsulfanyl-5-nitro-1,3-thiazol-4-amine |
|---|
| CAS Number | 127346-42-3 | Molecular Weight | 191.23100 |
|---|
| Density | 1.61g/cm3 | Boiling Point | 411.5ºC at 760 mmHg |
|---|
| Molecular Formula | C4H5N3O2S2 | Melting Point | 175-180ºC |
|---|
| MSDS | / | Flash Point | 202.7ºC |
|---|
Names
| Name | 2-methylsulfanyl-5-nitro-1,3-thiazol-4-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.61g/cm3 |
|---|
| Boiling Point | 411.5ºC at 760 mmHg |
|---|
| Melting Point | 175-180ºC |
|---|
| Molecular Formula | C4H5N3O2S2 |
|---|
| Molecular Weight | 191.23100 |
|---|
| Flash Point | 202.7ºC |
|---|
| Exact Mass | 190.98200 |
|---|
| PSA | 138.27000 |
|---|
| LogP | 2.45980 |
|---|
| Vapour Pressure | 5.54E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.682 |
|---|
| InChIKey | ZPCLHYJMLDEAHT-UHFFFAOYSA-N |
|---|
| SMILES | CSc1nc(N)c([N+](=O)[O-])s1 |
|---|
Synonyms
| 2-(methylthio)-5-nitrothiazol-4-amine |
| 4-Amino-2-methylthio-5-nitrothiazole |
| 4-Thiazolamine,2-(methylthio)-5-nitro |
| 2-(Methylthio)-5-Nitro-4-Thiazolamine |
