Introduction：Basic information about CAS 300353-42-8|3-cyclopentyl-2-(3,4-dichlorophenyl)-N-pyridin-2-ylpropanamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-cyclopentyl-2-(3,4-dichlorophenyl)-N-pyridin-2-ylpropanamide |
|---|
| CAS Number | 300353-42-8 | Molecular Weight | 363.28100 |
|---|
| Density | 1.286g/cm3 | Boiling Point | 557.8ºC at 760 mmHg |
|---|
| Molecular Formula | C19H20Cl2N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 291.1ºC |
|---|
Names
| Name | 3-cyclopentyl-2-(3,4-dichlorophenyl)-N-pyridin-2-ylpropanamide |
|---|
Chemical & Physical Properties
| Density | 1.286g/cm3 |
|---|
| Boiling Point | 557.8ºC at 760 mmHg |
|---|
| Molecular Formula | C19H20Cl2N2O |
|---|
| Molecular Weight | 363.28100 |
|---|
| Flash Point | 291.1ºC |
|---|
| Exact Mass | 362.09500 |
|---|
| PSA | 41.99000 |
|---|
| LogP | 5.76400 |
|---|
| Index of Refraction | 1.615 |
|---|
| InChIKey | RFZWICAONXFLJJ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Nc1ccccn1)C(CC1CCCC1)c1ccc(Cl)c(Cl)c1 |
|---|
