Introduction：Basic information about CAS 43083-13-2|3-Pyridinecarbonitrile,1,2-dihydro-2-oxo-6-phenyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Pyridinecarbonitrile,1,2-dihydro-2-oxo-6-phenyl- |
|---|
| CAS Number | 43083-13-2 | Molecular Weight | 196.20500 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 437ºC at 760mmHg |
|---|
| Molecular Formula | C12H8N2O | Melting Point | 353-355ºC |
|---|
| MSDS | / | Flash Point | 218.1ºC |
|---|
Names
| Name | 2-oxo-6-phenyl-1H-pyridine-3-carbonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 437ºC at 760mmHg |
|---|
| Melting Point | 353-355ºC |
|---|
| Molecular Formula | C12H8N2O |
|---|
| Molecular Weight | 196.20500 |
|---|
| Flash Point | 218.1ºC |
|---|
| Exact Mass | 196.06400 |
|---|
| PSA | 56.65000 |
|---|
| LogP | 1.91358 |
|---|
| Index of Refraction | 1.636 |
|---|
| InChIKey | KTUZHAVCKLQHCN-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1ccc(-c2ccccc2)[nH]c1=O |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-oxo-6-phenyl-1,2-dihydro-pyridine-3-carbonitrile |
| 3-Cyan-6-phenyl-2-pyridon |
| 3-Cyano-2-hydroxy-6-phenylpyridine |
| 2-Oxo-6-phenyl-1,2-dihydro-3-pyridinecarbonitrile |
| 2-hydroxy-6-phenylnicotinonitrile |
| 3-cyano-6-phenylpyridine-2(1H)-one |
| 2-hydroxy-6-phenylpyridine-3-carbonitrile |
| 2-Oxo-6-phenyl-1,2-dihydro-pyridin-3-carbonitril |
| 2-oxo-6-phenylhydropyridine-3-carbonitrile |
| 2-Hydroxy-6-phenylpyridine-3-carbonitrile |
| 1,2-dihydro-2-oxo-6-phenylpyridine-3-carbonitrile |
| 6-phenylpyrid-2-one-3-carbonitrile |
| 6-phenyl-3-cyano-2-pyridone |
