Introduction：Basic information about CAS 87736-79-6|2,2,2-Trifluoro-1-(4-methylphenyl)-O-[(4-methylphenyl)sulfonyl]oxime ethanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2,2-Trifluoro-1-(4-methylphenyl)-O-[(4-methylphenyl)sulfonyl]oxime ethanone |
|---|
| CAS Number | 87736-79-6 | Molecular Weight | 357.34700 |
|---|
| Density | 1.29g/cm3 | Boiling Point | 396.87ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14F3NO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 193.82ºC |
|---|
Names
| Name | 2,2,2-Trifluoro-1-(4-methylphenyl)-O-[(4-methylphenyl)sulfonyl]oxime ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.29g/cm3 |
|---|
| Boiling Point | 396.87ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14F3NO3S |
|---|
| Molecular Weight | 357.34700 |
|---|
| Flash Point | 193.82ºC |
|---|
| Exact Mass | 357.06500 |
|---|
| PSA | 64.11000 |
|---|
| LogP | 5.05610 |
|---|
| Index of Refraction | 1.527 |
|---|
| InChIKey | GHAOMANCFBUXTJ-HMMYKYKNSA-N |
|---|
| SMILES | Cc1ccc(C(=NOS(=O)(=O)c2ccc(C)cc2)C(F)(F)F)cc1 |
|---|
Synonyms
| 2,2,2-trifluoro-1-p-tolylethanone O-tosyl oxime |
| 2,2,2-Trifluoro-1-(4-methylphenyl)ethanone O-[(4-Methylphenyl)sulfonyl]oxime |
| 2,2,2-Trifluoro-1-(4-methylphenyl)ethanone O-Tosyl Oxime |
| 2,2,2-trifluoro-1-(4-methylphenyl)-1-ethanone O-(p-toulenesulfonyl) oxime |
| 4-Methyl-a,a,a-Trifluoroacetophenone Oxime Tosylate |
