Introduction:Basic information about CAS 30235-12-2|2-Cyano-6-methyl-4-nitropyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Cyano-6-methyl-4-nitropyridine |
|---|
| CAS Number | 30235-12-2 | Molecular Weight | 163.13300 |
|---|
| Density | 1.34g/cm3 | Boiling Point | 318.2ºC at 760mmHg |
|---|
| Molecular Formula | C7H5N3O2 | Melting Point | 74-79ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 146.2ºC |
|---|
| Symbol | GHS05, GHS06 | Signal Word | Danger |
|---|
Names
| Name | 6-methyl-4-nitropyridine-2-carbonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.34g/cm3 |
|---|
| Boiling Point | 318.2ºC at 760mmHg |
|---|
| Melting Point | 74-79ºC |
|---|
| Molecular Formula | C7H5N3O2 |
|---|
| Molecular Weight | 163.13300 |
|---|
| Flash Point | 146.2ºC |
|---|
| Exact Mass | 163.03800 |
|---|
| PSA | 82.50000 |
|---|
| LogP | 1.69308 |
|---|
| Index of Refraction | 1.57 |
|---|
| InChIKey | VITXYPUCOQUWPJ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc([N+](=O)[O-])cc(C#N)n1 |
|---|
Safety Information
| Symbol | GHS05, GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H315-H318-H335 |
|---|
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
|---|
| Hazard Codes | T: Toxic; |
|---|
| Risk Phrases | R25 |
|---|
| Safety Phrases | 26-39-45 |
|---|
| RIDADR | UN 2811 6.1/PG 3 |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-cyano-4-nitro-6-methylpyridine |
| 6-methyl-4-nitropicolinonitrile |
| 6-methyl-4-nitro-pyridine-2-carbonitrile |
| 2-Cyano-6-methyl-4-nitropyridin |
| 6-Methyl-4-nitropyridine-2-carbonitrile |
| 2-CYANO-6-METHYL-4-NITROPYRIDINE |