Introduction:Basic information about CAS 913955-35-8|3-Methyl-2-(trifluoromethyl)-1H-indole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Methyl-2-(trifluoromethyl)-1H-indole |
|---|
| CAS Number | 913955-35-8 | Molecular Weight | 199.17200 |
|---|
| Density | 1.313 | Boiling Point | 266ºC |
|---|
| Molecular Formula | C10H8F3N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 115ºC |
|---|
Names
| Name | 3-Methyl-2-(trifluoromethyl)-1H-indole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.313 |
|---|
| Boiling Point | 266ºC |
|---|
| Molecular Formula | C10H8F3N |
|---|
| Molecular Weight | 199.17200 |
|---|
| Flash Point | 115ºC |
|---|
| Exact Mass | 199.06100 |
|---|
| PSA | 15.79000 |
|---|
| LogP | 3.49510 |
|---|
| Index of Refraction | 1.55 |
|---|
| InChIKey | ZQTPBODDVRYHSY-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(C(F)(F)F)[nH]c2ccccc12 |
|---|
Synonyms
| 1-methyl-2-(trifluoromethyl)indole |
| 3-methyl-2-trifluoromethylindole |
| 1H-Indole,3-methyl-2-(trifluoromethyl) |