Introduction：Basic information about CAS 201677-59-0|(R)-N-(2-(Benzyloxy)-5-(2-bromo-1-hydroxyethyl)phenyl)formamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (R)-N-(2-(Benzyloxy)-5-(2-bromo-1-hydroxyethyl)phenyl)formamide |
|---|
| CAS Number | 201677-59-0 | Molecular Weight | 350.20700 |
|---|
| Density | 1.489 | Boiling Point | 559.644ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16BrNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 292.262°C |
|---|
Names
| Name | N-[5-[(1R)-2-bromo-1-hydroxyethyl]-2-phenylmethoxyphenyl]formamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.489 |
|---|
| Boiling Point | 559.644ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16BrNO3 |
|---|
| Molecular Weight | 350.20700 |
|---|
| Flash Point | 292.262°C |
|---|
| Exact Mass | 349.03100 |
|---|
| PSA | 58.56000 |
|---|
| LogP | 3.97110 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.652 |
|---|
| InChIKey | HKSUZIIGCSOMPX-HNNXBMFYSA-N |
|---|
| SMILES | O=CNc1cc(C(O)CBr)ccc1OCc1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| (R)-2-bromo-1-[4-(benzyloxy)-3-(formylamino)phenyl]ethanol |
| N-[5-((1R)-2-bromo-1-hydroxyethyl)-2-(phenylmethoxy)phenyl]carboxamide |
| Formamide,N-[5-(2-bromo-1-hydroxyethyl)-2-(phenylmethoxy)phenyl]-,(R) |
| (R)-N-[2-Benzyloxy-5-(2-bromo-1-hydroxy-ethyl)-phenyl]-formamide |
| N-(2-benzyloxy-5-(2-bromo-1(R)-hydroxyethyl)phenyl)formamide |
| (R)-N-[5-(2-Bromo-1-hydroxyethyl)-2-(phenylmethoxy)phenyl]formamide |
| N-(2-(benzyloxy)-5-((R)-2-bromo-1-hydroxyethyl)phenyl)formamide |
