Introduction：Basic information about CAS 54001-22-8|2-(4-chlorophenyl)-4-methyl-1,3-thiazole-5-carbonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-chlorophenyl)-4-methyl-1,3-thiazole-5-carbonyl chloride |
|---|
| CAS Number | 54001-22-8 | Molecular Weight | 272.15000 |
|---|
| Density | 1.417g/cm3 | Boiling Point | 395.6ºC at 760mmHg |
|---|
| Molecular Formula | C11H7Cl2NOS | Melting Point | 180ºC |
|---|
| MSDS | / | Flash Point | 193.1ºC |
|---|
Names
| Name | 2-(4-chlorophenyl)-4-methyl-1,3-thiazole-5-carbonyl chloride |
|---|
Chemical & Physical Properties
| Density | 1.417g/cm3 |
|---|
| Boiling Point | 395.6ºC at 760mmHg |
|---|
| Melting Point | 180ºC |
|---|
| Molecular Formula | C11H7Cl2NOS |
|---|
| Molecular Weight | 272.15000 |
|---|
| Flash Point | 193.1ºC |
|---|
| Exact Mass | 270.96300 |
|---|
| PSA | 58.20000 |
|---|
| LogP | 4.15090 |
|---|
| Index of Refraction | 1.617 |
|---|
| InChIKey | BCMARAXFBBVCJE-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc(-c2ccc(Cl)cc2)sc1C(=O)Cl |
|---|
Safety Information
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
